C20H18ClN3O4 — CID 126605179
N-(5-chloro-1,3-benzodioxol-4-yl)-5-(oxan-4-yloxy)quinazolin-4-amine (PubChem CID 126605179) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzodioxol-4-yl)-5-(oxan-4-yloxy)quinazolin-4-amine.
| Compound Name | N-(5-chloro-1,3-benzodioxol-4-yl)-5-(oxan-4-yloxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 126605179 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-(5-chloro-1,3-benzodioxol-4-yl)-5-(oxan-4-yloxy)quinazolin-4-amine |
| SMILES | Clc1ccc2c(c1Nc1ncnc3cccc(OC4CCOCC4)c13)OCO2 |
| InChI | InChI=1S/C20H18ClN3O4/c21-13-4-5-16-19(27-11-26-16)18(13)24-20-17-14(22-10-23-20)2-1-3-15(17)28-12-6-8-25-9-7-12/h1-5,10,12H,6-9,11H2,(H,22,23,24) |
| InChIKey | XOGZFDOFONCLLI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |