C19H19ClN4O4 — CID 135430668
4-[(2-chloro-5-methoxy-3-pyridinyl)amino]-5-(oxan-4-yloxy)quinazolin-7-ol (PubChem CID 135430668) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is 4-[(2-chloro-5-methoxy-3-pyridinyl)amino]-5-(oxan-4-yloxy)quinazolin-7-ol.
| Compound Name | 4-[(2-chloro-5-methoxy-3-pyridinyl)amino]-5-(oxan-4-yloxy)quinazolin-7-ol |
|---|---|
| PubChem CID | 135430668 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-[(2-chloro-5-methoxy-3-pyridinyl)amino]-5-(oxan-4-yloxy)quinazolin-7-ol |
| SMILES | COc1cnc(Cl)c(Nc2ncnc3cc(O)cc(OC4CCOCC4)c23)c1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-26-13-8-15(18(20)21-9-13)24-19-17-14(22-10-23-19)6-11(25)7-16(17)28-12-2-4-27-5-3-12/h6-10,12,25H,2-5H2,1H3,(H,22,23,24) |
| InChIKey | OIHNCJZYDXDGRU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|