C23H24ClN3O5 — CID 86594820
N-(2-chloro-5-methoxyphenyl)-5-(oxan-4-yloxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinazolin-4-amine (PubChem CID 86594820) has the molecular formula C23H24ClN3O5 and a molecular weight of 457.91 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-5-(oxan-4-yloxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinazolin-4-amine.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-5-(oxan-4-yloxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 86594820 |
| Molecular Formula | C23H24ClN3O5 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-5-(oxan-4-yloxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinazolin-4-amine |
| SMILES | COc1ccc(Cl)c(Nc2ncnc3cc(OC[C@H]4CO4)cc(OC4CCOCC4)c23)c1 |
| InChI | InChI=1S/C23H24ClN3O5/c1-28-15-2-3-18(24)19(8-15)27-23-22-20(25-13-26-23)9-16(30-11-17-12-31-17)10-21(22)32-14-4-6-29-7-5-14/h2-3,8-10,13-14,17H,4-7,11-12H2,1H3,(H,25,26,27)/t17-/m0/s1 |
| InChIKey | JXDAIWSXEHPETI-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|