C30H37NO3 — CID 126609756
[(E)-[(2Z,4E)-2-methyl-5-(2-methylphenyl)-6-oxo-1-phenyltrideca-2,4-dien-7-ylidene]amino] propanoate (PubChem CID 126609756) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is [(E)-[(2Z,4E)-2-methyl-5-(2-methylphenyl)-6-oxo-1-phenyltrideca-2,4-dien-7-ylidene]amino] propanoate.
| Compound Name | [(E)-[(2Z,4E)-2-methyl-5-(2-methylphenyl)-6-oxo-1-phenyltrideca-2,4-dien-7-ylidene]amino] propanoate |
|---|---|
| PubChem CID | 126609756 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | [(E)-[(2Z,4E)-2-methyl-5-(2-methylphenyl)-6-oxo-1-phenyltrideca-2,4-dien-7-ylidene]amino] propanoate |
| SMILES | CCCCCC/C(=N\OC(=O)CC)C(=O)/C(=C/C=C(/C)Cc1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C30H37NO3/c1-5-7-8-12-19-28(31-34-29(32)6-2)30(33)27(26-18-14-13-15-24(26)4)21-20-23(3)22-25-16-10-9-11-17-25/h9-11,13-18,20-21H,5-8,12,19,22H2,1-4H3/b23-20-,27-21+,31-28+ |
| InChIKey | VQQBMMLJISLYLD-OMYVTDBOSA-N |
| XLogP | 7.42 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|