C29H31NO4 — CID 145261115
[(E)-[(E)-1-(2-acetylphenyl)-4-(2-methylphenyl)-5-oxododec-3-en-1-yn-6-ylidene]amino] acetate (PubChem CID 145261115) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is [(E)-[(E)-1-(2-acetylphenyl)-4-(2-methylphenyl)-5-oxododec-3-en-1-yn-6-ylidene]amino] acetate.
| Compound Name | [(E)-[(E)-1-(2-acetylphenyl)-4-(2-methylphenyl)-5-oxododec-3-en-1-yn-6-ylidene]amino] acetate |
|---|---|
| PubChem CID | 145261115 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [(E)-[(E)-1-(2-acetylphenyl)-4-(2-methylphenyl)-5-oxododec-3-en-1-yn-6-ylidene]amino] acetate |
| SMILES | CCCCCC/C(=N\OC(C)=O)C(=O)/C(=C/C#Cc1ccccc1C(C)=O)c1ccccc1C |
| InChI | InChI=1S/C29H31NO4/c1-5-6-7-8-20-28(30-34-23(4)32)29(33)27(25-17-11-9-14-21(25)2)19-13-16-24-15-10-12-18-26(24)22(3)31/h9-12,14-15,17-19H,5-8,20H2,1-4H3/b27-19+,30-28+ |
| InChIKey | KZUZOGSLQXYDBX-KDEARYMESA-N |
| XLogP | 6.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|