C12H15Cl2NO — CID 126611053
(2R,5R)-3-(3,4-dichlorophenyl)-5-ethyl-2-methyl-1,3-oxazolidine (PubChem CID 126611053) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is (2R,5R)-3-(3,4-dichlorophenyl)-5-ethyl-2-methyl-1,3-oxazolidine.
| Compound Name | (2R,5R)-3-(3,4-dichlorophenyl)-5-ethyl-2-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 126611053 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (2R,5R)-3-(3,4-dichlorophenyl)-5-ethyl-2-methyl-1,3-oxazolidine |
| SMILES | CC[C@@H]1CN(c2ccc(Cl)c(Cl)c2)[C@@H](C)O1 |
| InChI | InChI=1S/C12H15Cl2NO/c1-3-10-7-15(8(2)16-10)9-4-5-11(13)12(14)6-9/h4-6,8,10H,3,7H2,1-2H3/t8-,10-/m1/s1 |
| InChIKey | AOVLGKVKCAZBAW-PSASIEDQSA-N |
| XLogP | 3.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |