C12H14Cl2O — CID 90089094
2-(3,4-dichlorophenyl)-5-ethyloxolane (PubChem CID 90089094) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-ethyloxolane.
| Compound Name | 2-(3,4-dichlorophenyl)-5-ethyloxolane |
|---|---|
| PubChem CID | 90089094 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-ethyloxolane |
| SMILES | CCC1CCC(c2ccc(Cl)c(Cl)c2)O1 |
| InChI | InChI=1S/C12H14Cl2O/c1-2-9-4-6-12(15-9)8-3-5-10(13)11(14)7-8/h3,5,7,9,12H,2,4,6H2,1H3 |
| InChIKey | HSOXHGOISUJMKQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |