C12H12Cl2O3S — CID 56639300
2-(3,4-dichlorophenyl)-6-methylsulfonyl-3,4-dihydro-2H-pyran (PubChem CID 56639300) has the molecular formula C12H12Cl2O3S and a molecular weight of 307.20 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-6-methylsulfonyl-3,4-dihydro-2H-pyran.
| Compound Name | 2-(3,4-dichlorophenyl)-6-methylsulfonyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 56639300 |
| Molecular Formula | C12H12Cl2O3S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-6-methylsulfonyl-3,4-dihydro-2H-pyran |
| SMILES | CS(=O)(=O)C1=CCCC(c2ccc(Cl)c(Cl)c2)O1 |
| InChI | InChI=1S/C12H12Cl2O3S/c1-18(15,16)12-4-2-3-11(17-12)8-5-6-9(13)10(14)7-8/h4-7,11H,2-3H2,1H3 |
| InChIKey | GXFWJKOIHUQRFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |