C21H18ClN5 — CID 126616965
[2-[6-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-pyridinyl]-1,3-dihydroinden-2-yl]methanamine (PubChem CID 126616965) has the molecular formula C21H18ClN5 and a molecular weight of 375.86 g/mol. Its IUPAC name is [2-[6-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-pyridinyl]-1,3-dihydroinden-2-yl]methanamine.
| Compound Name | [2-[6-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-pyridinyl]-1,3-dihydroinden-2-yl]methanamine |
|---|---|
| PubChem CID | 126616965 |
| Molecular Formula | C21H18ClN5 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-[6-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-pyridinyl]-1,3-dihydroinden-2-yl]methanamine |
| SMILES | NCC1(c2cc(-c3ncnc4[nH]ccc34)cc(Cl)n2)Cc2ccccc2C1 |
| InChI | InChI=1S/C21H18ClN5/c22-18-8-15(19-16-5-6-24-20(16)26-12-25-19)7-17(27-18)21(11-23)9-13-3-1-2-4-14(13)10-21/h1-8,12H,9-11,23H2,(H,24,25,26) |
| InChIKey | VSVGGMJUGAWNIF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|