C7H6ClN3 — CID 172694459
4-(chloromethyl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 172694459) has the molecular formula C7H6ClN3 and a molecular weight of 167.60 g/mol. Its IUPAC name is 4-(chloromethyl)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(chloromethyl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 172694459 |
| Molecular Formula | C7H6ClN3 |
| Molecular Weight | 167.60 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 4-(chloromethyl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | ClCc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C7H6ClN3/c8-3-6-5-1-2-9-7(5)11-4-10-6/h1-2,4H,3H2,(H,9,10,11) |
| InChIKey | CDCCPANZVHQPQD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|