C6H4N3S- — CID 59609036
7H-pyrrolo[2,3-d]pyrimidine-4-thiolate (PubChem CID 59609036) has the molecular formula C6H4N3S- and a molecular weight of 150.19 g/mol. Its IUPAC name is 7H-pyrrolo[2,3-d]pyrimidine-4-thiolate.
| Compound Name | 7H-pyrrolo[2,3-d]pyrimidine-4-thiolate |
|---|---|
| PubChem CID | 59609036 |
| Molecular Formula | C6H4N3S- |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 7H-pyrrolo[2,3-d]pyrimidine-4-thiolate |
| SMILES | [S-]c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C6H5N3S/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H,(H2,7,8,9,10)/p-1 |
| InChIKey | HTDPDLVWFWOIBZ-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|