C20H19N5O4 — CID 126617746
8-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]pyrimido[1,2-a]benzimidazole-2-carboxamide (PubChem CID 126617746) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 8-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]pyrimido[1,2-a]benzimidazole-2-carboxamide.
| Compound Name | 8-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]pyrimido[1,2-a]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 126617746 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 8-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]pyrimido[1,2-a]benzimidazole-2-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2ccn3c(n2)nc2cc(OC)ccc23)cn1 |
| InChI | InChI=1S/C20H19N5O4/c1-27-9-10-29-18-6-3-13(12-21-18)22-19(26)15-7-8-25-17-5-4-14(28-2)11-16(17)24-20(25)23-15/h3-8,11-12H,9-10H2,1-2H3,(H,22,26) |
| InChIKey | HZRRIUNSTQRKOL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|