C17H18Cl2F2N2O — CID 126618621
(2S,4R)-N-(6-chloro-6-fluoro-5-phenylcyclohexa-2,4-dien-1-yl)-4-fluoropyrrolidine-2-carboxamide;hydrochloride (PubChem CID 126618621) has the molecular formula C17H18Cl2F2N2O and a molecular weight of 375.25 g/mol. Its IUPAC name is (2S,4R)-N-(6-chloro-6-fluoro-5-phenylcyclohexa-2,4-dien-1-yl)-4-fluoropyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S,4R)-N-(6-chloro-6-fluoro-5-phenylcyclohexa-2,4-dien-1-yl)-4-fluoropyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126618621 |
| Molecular Formula | C17H18Cl2F2N2O |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (2S,4R)-N-(6-chloro-6-fluoro-5-phenylcyclohexa-2,4-dien-1-yl)-4-fluoropyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1C=CC=C(c2ccccc2)C1(F)Cl)[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C17H17ClF2N2O.ClH/c18-17(20)13(11-5-2-1-3-6-11)7-4-8-15(17)22-16(23)14-9-12(19)10-21-14;/h1-8,12,14-15,21H,9-10H2,(H,22,23);1H/t12-,14+,15?,17?;/m1./s1 |
| InChIKey | MJWQNWYRZCDMSM-VJCVCCJCSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|