About furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate
furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate (PubChem CID 126623530) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate.
Molecular Properties
| Compound Name | furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate |
| PubChem CID | 126623530 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCO.O=Cc1ccco1 |
| InChI | InChI=1S/C6H10O4.C5H4O2/c1-5(8)2-3-6(9)10-4-7;6-4-5-2-1-3-7-5/h7H,2-4H2,1H3;1-4H |
| InChIKey | QMQHQVQKKNHBTI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate?
The IUPAC name of furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate (CID 126623530) is furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate.
What is the SMILES notation for furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate?
The canonical SMILES for furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate is CC(=O)CCC(=O)OCO.O=Cc1ccco1.
What is the InChIKey of furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate?
The InChIKey is QMQHQVQKKNHBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.C5H4O2/c1-5(8)2-3-6(9)10-4-7;6-4-5-2-1-3-7-5/h7H,2-4H2,1H3;1-4H.
What are the key properties of furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate?
furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate has a molecular weight of 242.23 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carbaldehyde;hydroxymethyl 4-oxopentanoate is sourced from PubChem (CID 126623530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).