About 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate
5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate (PubChem CID 175135837) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate.
Molecular Properties
| Compound Name | 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate |
| PubChem CID | 175135837 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate |
| SMILES | COC(=O)CCC(C)=O.Cc1ccc(C=O)o1 |
| InChI | InChI=1S/C6H10O3.C6H6O2/c1-5(7)3-4-6(8)9-2;1-5-2-3-6(4-7)8-5/h3-4H2,1-2H3;2-4H,1H3 |
| InChIKey | IUCRFFRBHVTAGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate?
The IUPAC name of 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate (CID 175135837) is 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate.
What is the SMILES notation for 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate?
The canonical SMILES for 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate is COC(=O)CCC(C)=O.Cc1ccc(C=O)o1.
What is the InChIKey of 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate?
The InChIKey is IUCRFFRBHVTAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H6O2/c1-5(7)3-4-6(8)9-2;1-5-2-3-6(4-7)8-5/h3-4H2,1-2H3;2-4H,1H3.
What are the key properties of 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate?
5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate has a molecular weight of 240.25 g/mol, XLogP of 1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylfuran-2-carbaldehyde;methyl 4-oxopentanoate is sourced from PubChem (CID 175135837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).