C28H27ClN8O3 — CID 126623805
5-[(6-chloropyridazin-3-yl)amino]-1-[2-[(4R)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indole-3-carboxamide (PubChem CID 126623805) has the molecular formula C28H27ClN8O3 and a molecular weight of 559.03 g/mol. Its IUPAC name is 5-[(6-chloropyridazin-3-yl)amino]-1-[2-[(4R)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indole-3-carboxamide.
| Compound Name | 5-[(6-chloropyridazin-3-yl)amino]-1-[2-[(4R)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 126623805 |
| Molecular Formula | C28H27ClN8O3 |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 5-[(6-chloropyridazin-3-yl)amino]-1-[2-[(4R)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indole-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2[C@@H]3CCC(C3)N2C(=O)Cn2cc(C(N)=O)c3cc(Nc4ccc(Cl)nn4)ccc32)n1 |
| InChI | InChI=1S/C28H27ClN8O3/c1-15-3-2-4-23(31-15)33-28(40)26-16-5-7-18(11-16)37(26)25(38)14-36-13-20(27(30)39)19-12-17(6-8-21(19)36)32-24-10-9-22(29)34-35-24/h2-4,6,8-10,12-13,16,18,26H,5,7,11,14H2,1H3,(H2,30,39)(H,32,35)(H,31,33,40)/t16-,18?,26?/m1/s1 |
| InChIKey | XQMAPWRUEWYQRY-GIJGRZNKSA-N |
| XLogP | 3.65 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |