C31H33N7O3 — CID 126643289
1-[2-[(1R,3R,4S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)indole-3-carboxamide (PubChem CID 126643289) has the molecular formula C31H33N7O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is 1-[2-[(1R,3R,4S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)indole-3-carboxamide.
| Compound Name | 1-[2-[(1R,3R,4S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)indole-3-carboxamide |
|---|---|
| PubChem CID | 126643289 |
| Molecular Formula | C31H33N7O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 1-[2-[(1R,3R,4S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)indole-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@H]2[C@H]3CC[C@H](C3)N2C(=O)Cn2cc(C(N)=O)c3cc(-c4cnc5n4CCCC5)ccc32)n1 |
| InChI | InChI=1S/C31H33N7O3/c1-18-5-4-6-26(34-18)35-31(41)29-20-8-10-21(13-20)38(29)28(39)17-36-16-23(30(32)40)22-14-19(9-11-24(22)36)25-15-33-27-7-2-3-12-37(25)27/h4-6,9,11,14-16,20-21,29H,2-3,7-8,10,12-13,17H2,1H3,(H2,32,40)(H,34,35,41)/t20-,21+,29+/m0/s1 |
| InChIKey | JTSZRCGGZHYTBB-BNJCFXFUSA-N |
| XLogP | 3.66 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |