C24H26N5O6P — CID 126628912
[3-carbamoyl-1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indol-5-yl]phosphonic acid (PubChem CID 126628912) has the molecular formula C24H26N5O6P and a molecular weight of 511.48 g/mol. Its IUPAC name is [3-carbamoyl-1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indol-5-yl]phosphonic acid.
| Compound Name | [3-carbamoyl-1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indol-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 126628912 |
| Molecular Formula | C24H26N5O6P |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | [3-carbamoyl-1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indol-5-yl]phosphonic acid |
| SMILES | Cc1cccc(NC(=O)[C@@H]2C3CCC(C3)N2C(=O)Cn2cc(C(N)=O)c3cc(P(=O)(O)O)ccc32)n1 |
| InChI | InChI=1S/C24H26N5O6P/c1-13-3-2-4-20(26-13)27-24(32)22-14-5-6-15(9-14)29(22)21(30)12-28-11-18(23(25)31)17-10-16(36(33,34)35)7-8-19(17)28/h2-4,7-8,10-11,14-15,22H,5-6,9,12H2,1H3,(H2,25,31)(H,26,27,32)(H2,33,34,35)/t14?,15?,22-/m0/s1 |
| InChIKey | BQVGHSYAJTZUAZ-MRHLONDUSA-N |
| XLogP | 1.26 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|