C9H17N5O — CID 126627369
2,2,4-trimethyl-4-(2H-tetrazol-5-yl)pentanamide (PubChem CID 126627369) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(2H-tetrazol-5-yl)pentanamide.
| Compound Name | 2,2,4-trimethyl-4-(2H-tetrazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 126627369 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2,2,4-trimethyl-4-(2H-tetrazol-5-yl)pentanamide |
| SMILES | CC(C)(CC(C)(C)c1nn[nH]n1)C(N)=O |
| InChI | InChI=1S/C9H17N5O/c1-8(2,6(10)15)5-9(3,4)7-11-13-14-12-7/h5H2,1-4H3,(H2,10,15)(H,11,12,13,14) |
| InChIKey | MNZRSHCQIJVBCF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |