C73H51N3 — CID 126632871
2-(10,10-dimethyl-12H-indeno[2,3-b]fluoren-12-yl)-4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 126632871) has the molecular formula C73H51N3 and a molecular weight of 970.23 g/mol. Its IUPAC name is 2-(10,10-dimethyl-12H-indeno[2,3-b]fluoren-12-yl)-4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(10,10-dimethyl-12H-indeno[2,3-b]fluoren-12-yl)-4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 126632871 |
| Molecular Formula | C73H51N3 |
| Molecular Weight | 970.23 g/mol |
| Exact Mass | 969.41 |
| IUPAC Name | 2-(10,10-dimethyl-12H-indeno[2,3-b]fluoren-12-yl)-4,6-bis[3-(3,5-diphenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)C(c1nc(-c2cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c2)nc(-c2cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c2)n1)c1ccccc1-3 |
| InChI | InChI=1S/C73H51N3/c1-73(2)67-36-18-17-34-62(67)65-45-64-61-33-15-16-35-63(61)69(66(64)46-68(65)73)72-75-70(53-31-19-29-51(37-53)59-41-55(47-21-7-3-8-22-47)39-56(42-59)48-23-9-4-10-24-48)74-71(76-72)54-32-20-30-52(38-54)60-43-57(49-25-11-5-12-26-49)40-58(44-60)50-27-13-6-14-28-50/h3-46,69H,1-2H3 |
| InChIKey | VPPKZVPRDOCOSC-UHFFFAOYSA-N |
| XLogP | 18.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.23 |
| LogP ≤ 5 | 18.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |