C23H27ClN4O6S2 — CID 126634066
tert-butyl N-[(5S)-5-[5-(benzamidocarbamoyl)-3-chlorothiophen-2-yl]-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate (PubChem CID 126634066) has the molecular formula C23H27ClN4O6S2 and a molecular weight of 555.08 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[5-(benzamidocarbamoyl)-3-chlorothiophen-2-yl]-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[5-(benzamidocarbamoyl)-3-chlorothiophen-2-yl]-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 126634066 |
| Molecular Formula | C23H27ClN4O6S2 |
| Molecular Weight | 555.08 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | tert-butyl N-[(5S)-5-[5-(benzamidocarbamoyl)-3-chlorothiophen-2-yl]-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate |
| SMILES | CC1C(NC(=O)OC(C)(C)C)=N[C@](C)(c2sc(C(=O)NNC(=O)c3ccccc3)cc2Cl)CS1(=O)=O |
| InChI | InChI=1S/C23H27ClN4O6S2/c1-13-18(25-21(31)34-22(2,3)4)26-23(5,12-36(13,32)33)17-15(24)11-16(35-17)20(30)28-27-19(29)14-9-7-6-8-10-14/h6-11,13H,12H2,1-5H3,(H,27,29)(H,28,30)(H,25,26,31)/t13?,23-/m0/s1 |
| InChIKey | SXVDLEYFCQTSHY-XXXNXYCNSA-N |
| XLogP | 3.43 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.08 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|