C26H32ClN5O4S2 — CID 123805347
tert-butyl N-[5-[3-chloro-5-(3,4-dimethyl-1-phenyl-4H-pyridazin-5-yl)thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 123805347) has the molecular formula C26H32ClN5O4S2 and a molecular weight of 578.16 g/mol. Its IUPAC name is tert-butyl N-[5-[3-chloro-5-(3,4-dimethyl-1-phenyl-4H-pyridazin-5-yl)thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[3-chloro-5-(3,4-dimethyl-1-phenyl-4H-pyridazin-5-yl)thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 123805347 |
| Molecular Formula | C26H32ClN5O4S2 |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | tert-butyl N-[5-[3-chloro-5-(3,4-dimethyl-1-phenyl-4H-pyridazin-5-yl)thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CC1=NN(c2ccccc2)C=C(c2cc(Cl)c(C3(C)CS(=O)(=O)N(C)C(NC(=O)OC(C)(C)C)=N3)s2)C1C |
| InChI | InChI=1S/C26H32ClN5O4S2/c1-16-17(2)30-32(18-11-9-8-10-12-18)14-19(16)21-13-20(27)22(37-21)26(6)15-38(34,35)31(7)23(29-26)28-24(33)36-25(3,4)5/h8-14,16H,15H2,1-7H3,(H,28,29,33) |
| InChIKey | RCWDNHPPZHIGRS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |