C17H20BrClN4O4S2 — CID 118424744
tert-butyl N-[(5S)-5-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 118424744) has the molecular formula C17H20BrClN4O4S2 and a molecular weight of 523.86 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 118424744 |
| Molecular Formula | C17H20BrClN4O4S2 |
| Molecular Weight | 523.86 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | tert-butyl N-[(5S)-5-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=N[C@](C)(c2sc3c(Br)nccc3c2Cl)CS1(=O)=O |
| InChI | InChI=1S/C17H20BrClN4O4S2/c1-16(2,3)27-15(24)21-14-22-17(4,8-29(25,26)23(14)5)12-10(19)9-6-7-20-13(18)11(9)28-12/h6-7H,8H2,1-5H3,(H,21,22,24)/t17-/m0/s1 |
| InChIKey | MFOCAIAPKRPCRC-KRWDZBQOSA-N |
| XLogP | 4.08 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|