C22H25ClN4O4S2 — CID 126634264
tert-butyl N-[(5S)-5-(3-chloro-5-imidazo[1,2-a]pyridin-2-ylthiophen-2-yl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate (PubChem CID 126634264) has the molecular formula C22H25ClN4O4S2 and a molecular weight of 509.05 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-(3-chloro-5-imidazo[1,2-a]pyridin-2-ylthiophen-2-yl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-(3-chloro-5-imidazo[1,2-a]pyridin-2-ylthiophen-2-yl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 126634264 |
| Molecular Formula | C22H25ClN4O4S2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | tert-butyl N-[(5S)-5-(3-chloro-5-imidazo[1,2-a]pyridin-2-ylthiophen-2-yl)-2,5-dimethyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-yl]carbamate |
| SMILES | CC1C(NC(=O)OC(C)(C)C)=N[C@](C)(c2sc(-c3cn4ccccc4n3)cc2Cl)CS1(=O)=O |
| InChI | InChI=1S/C22H25ClN4O4S2/c1-13-19(25-20(28)31-21(2,3)4)26-22(5,12-33(13,29)30)18-14(23)10-16(32-18)15-11-27-9-7-6-8-17(27)24-15/h6-11,13H,12H2,1-5H3,(H,25,26,28)/t13?,22-/m0/s1 |
| InChIKey | JICDPERHXUWVTL-OGDGHAERSA-N |
| XLogP | 4.67 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |