C9H11NO2 — CID 126635369
1-[(E)-pent-2-en-3-yl]pyrrole-2,5-dione (PubChem CID 126635369) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-[(E)-pent-2-en-3-yl]pyrrole-2,5-dione.
| Compound Name | 1-[(E)-pent-2-en-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 126635369 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-[(E)-pent-2-en-3-yl]pyrrole-2,5-dione |
| SMILES | C/C=C(\CC)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO2/c1-3-7(4-2)10-8(11)5-6-9(10)12/h3,5-6H,4H2,1-2H3/b7-3+ |
| InChIKey | BUJXREZHLZPTLD-XVNBXDOJSA-N |
| XLogP | 1.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|