C13H12N2O5 — CID 160814240
1-[3-(2,5-dioxopyrrol-1-yl)but-3-enyl]pyrrole-2,5-dione;formaldehyde (PubChem CID 160814240) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrol-1-yl)but-3-enyl]pyrrole-2,5-dione;formaldehyde.
| Compound Name | 1-[3-(2,5-dioxopyrrol-1-yl)but-3-enyl]pyrrole-2,5-dione;formaldehyde |
|---|---|
| PubChem CID | 160814240 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrol-1-yl)but-3-enyl]pyrrole-2,5-dione;formaldehyde |
| SMILES | C=C(CCN1C(=O)C=CC1=O)N1C(=O)C=CC1=O.C=O |
| InChI | InChI=1S/C12H10N2O4.CH2O/c1-8(14-11(17)4-5-12(14)18)6-7-13-9(15)2-3-10(13)16;1-2/h2-5H,1,6-7H2;1H2 |
| InChIKey | SERVLKJCULODFW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|