C56H55ClN2 — CID 126638746
5-[2-[3-chloro-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-4-methyl-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine (PubChem CID 126638746) has the molecular formula C56H55ClN2 and a molecular weight of 791.52 g/mol. Its IUPAC name is 5-[2-[3-chloro-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-4-methyl-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine.
| Compound Name | 5-[2-[3-chloro-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-4-methyl-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine |
|---|---|
| PubChem CID | 126638746 |
| Molecular Formula | C56H55ClN2 |
| Molecular Weight | 791.52 g/mol |
| Exact Mass | 790.41 |
| IUPAC Name | 5-[2-[3-chloro-5-[2-[4-methyl-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-4-methyl-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)pyridine |
| SMILES | Cc1cc(-c2ccc3c(c2)C(C)(C)CC3(C)C)ncc1-c1ccccc1-c1cc(Cl)cc(-c2ccccc2-c2cnc(-c3ccc4c(c3)C(C)(C)CC4(C)C)cc2C)c1 |
| InChI | InChI=1S/C56H55ClN2/c1-34-23-51(36-19-21-47-49(28-36)55(7,8)32-53(47,3)4)58-30-45(34)43-17-13-11-15-41(43)38-25-39(27-40(57)26-38)42-16-12-14-18-44(42)46-31-59-52(24-35(46)2)37-20-22-48-50(29-37)56(9,10)33-54(48,5)6/h11-31H,32-33H2,1-10H3 |
| InChIKey | MVYPQNGZVBASQC-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.52 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |