C16H21BrFN3O3 — CID 126643499
tert-butyl (2S,4R)-2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoro-4-methylpyrrolidine-1-carboxylate (PubChem CID 126643499) has the molecular formula C16H21BrFN3O3 and a molecular weight of 402.26 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoro-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoro-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126643499 |
| Molecular Formula | C16H21BrFN3O3 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(6-bromo-2-pyridinyl)carbamoyl]-4-fluoro-4-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@](C)(F)C[C@H]1C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C16H21BrFN3O3/c1-15(2,3)24-14(23)21-9-16(4,18)8-10(21)13(22)20-12-7-5-6-11(17)19-12/h5-7,10H,8-9H2,1-4H3,(H,19,20,22)/t10-,16+/m0/s1 |
| InChIKey | FLSXXUHGZNPTOE-MGPLVRAMSA-N |
| XLogP | 3.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|