C17H23BrN4O3 — CID 126653827
tert-butyl (3S)-5-(aminomethyl)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 126653827) has the molecular formula C17H23BrN4O3 and a molecular weight of 411.30 g/mol. Its IUPAC name is tert-butyl (3S)-5-(aminomethyl)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (3S)-5-(aminomethyl)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 126653827 |
| Molecular Formula | C17H23BrN4O3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | tert-butyl (3S)-5-(aminomethyl)-3-[(6-bromo-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC2(CN)C[C@H]1C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C17H23BrN4O3/c1-16(2,3)25-15(24)22-10(7-17(9-19)8-11(17)22)14(23)21-13-6-4-5-12(18)20-13/h4-6,10-11H,7-9,19H2,1-3H3,(H,20,21,23)/t10-,11?,17?/m0/s1 |
| InChIKey | BEXIRDAFGYQDHM-KCCQOBMMSA-N |
| XLogP | 2.51 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|