C26H35BrN4O5 — CID 142420833
tert-butyl (3S)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-[(pent-4-enoylamino)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 142420833) has the molecular formula C26H35BrN4O5 and a molecular weight of 563.49 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-[(pent-4-enoylamino)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-[(pent-4-enoylamino)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 142420833 |
| Molecular Formula | C26H35BrN4O5 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | tert-butyl (3S)-3-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-5-[(pent-4-enoylamino)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C=CCCC(=O)NCC12CC1N(C(=O)OC(C)(C)C)[C@H](C(=O)Nc1nc(Br)ccc1COCC=C)C2 |
| InChI | InChI=1S/C26H35BrN4O5/c1-6-8-9-21(32)28-16-26-13-18(31(19(26)14-26)24(34)36-25(3,4)5)23(33)30-22-17(15-35-12-7-2)10-11-20(27)29-22/h6-7,10-11,18-19H,1-2,8-9,12-16H2,3-5H3,(H,28,32)(H,29,30,33)/t18-,19?,26?/m0/s1 |
| InChIKey | APACQJVMTGWIPG-IXQXIYAPSA-N |
| XLogP | 4.34 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|