C26H38BrN3O5 — CID 170085006
tert-butyl (2R,3R,5S)-5-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-2,3-dimethyl-3-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxylate (PubChem CID 170085006) has the molecular formula C26H38BrN3O5 and a molecular weight of 552.51 g/mol. Its IUPAC name is tert-butyl (2R,3R,5S)-5-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-2,3-dimethyl-3-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,5S)-5-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-2,3-dimethyl-3-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170085006 |
| Molecular Formula | C26H38BrN3O5 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | tert-butyl (2R,3R,5S)-5-[[6-bromo-3-(prop-2-enoxymethyl)-2-pyridinyl]carbamoyl]-2,3-dimethyl-3-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOCC[C@@]1(C)C[C@@H](C(=O)Nc2nc(Br)ccc2COCC=C)N(C(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C26H38BrN3O5/c1-8-13-33-15-12-26(7)16-20(30(18(26)3)24(32)35-25(4,5)6)23(31)29-22-19(17-34-14-9-2)10-11-21(27)28-22/h8-11,18,20H,1-2,12-17H2,3-7H3,(H,28,29,31)/t18-,20+,26+/m1/s1 |
| InChIKey | UIRITGFXJTVMLP-FXABVQRQSA-N |
| XLogP | 5.48 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|