C19H26BrN3O6S — CID 126670752
tert-butyl (3S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(methylsulfonyloxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 126670752) has the molecular formula C19H26BrN3O6S and a molecular weight of 504.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(methylsulfonyloxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(methylsulfonyloxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 126670752 |
| Molecular Formula | C19H26BrN3O6S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | tert-butyl (3S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(methylsulfonyloxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | Cc1ccc(Br)nc1NC(=O)[C@@H]1CC2(COS(C)(=O)=O)CC2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26BrN3O6S/c1-11-6-7-14(20)21-15(11)22-16(24)12-8-19(10-28-30(5,26)27)9-13(19)23(12)17(25)29-18(2,3)4/h6-7,12-13H,8-10H2,1-5H3,(H,21,22,24)/t12-,13?,19?/m0/s1 |
| InChIKey | FAKZJSNVJBJIFS-GLIABKTBSA-N |
| XLogP | 2.84 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|