C18H20BrN3O4 — CID 135317992
(1R,3S,5S)-3-[(6-bromo-3-ethenyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 135317992) has the molecular formula C18H20BrN3O4 and a molecular weight of 422.28 g/mol. Its IUPAC name is (1R,3S,5S)-3-[(6-bromo-3-ethenyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,3S,5S)-3-[(6-bromo-3-ethenyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 135317992 |
| Molecular Formula | C18H20BrN3O4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (1R,3S,5S)-3-[(6-bromo-3-ethenyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | C=CCOC[C@@]12C[C@@H](C(=O)Nc3nc(Br)ccc3C=C)N(C(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C18H20BrN3O4/c1-3-7-26-10-18-8-12(22(17(24)25)13(18)9-18)16(23)21-15-11(4-2)5-6-14(19)20-15/h3-6,12-13H,1-2,7-10H2,(H,24,25)(H,20,21,23)/t12-,13+,18-/m0/s1 |
| InChIKey | LHVKLERLTAXLKF-JCGVRSQUSA-N |
| XLogP | 3.14 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|