C19H21BrF3N3O4 — CID 175706368
(1R,3S,5S)-N-(6-bromo-3-ethenyl-2-pyridinyl)-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175706368) has the molecular formula C19H21BrF3N3O4 and a molecular weight of 492.29 g/mol. Its IUPAC name is (1R,3S,5S)-N-(6-bromo-3-ethenyl-2-pyridinyl)-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,3S,5S)-N-(6-bromo-3-ethenyl-2-pyridinyl)-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175706368 |
| Molecular Formula | C19H21BrF3N3O4 |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | (1R,3S,5S)-N-(6-bromo-3-ethenyl-2-pyridinyl)-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOC[C@@]12C[C@@H](C(=O)Nc3nc(Br)ccc3C=C)N[C@@H]1C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20BrN3O2.C2HF3O2/c1-3-7-23-10-17-8-12(19-13(17)9-17)16(22)21-15-11(4-2)5-6-14(18)20-15;3-2(4,5)1(6)7/h3-6,12-13,19H,1-2,7-10H2,(H,20,21,22);(H,6,7)/t12-,13+,17-;/m0./s1 |
| InChIKey | FUGLHBOORYTROO-LBZTUKFJSA-N |
| XLogP | 3.38 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|