C23H29BrN2O4 — CID 162089578
tert-butyl (1R,3S,5S)-3-[2-(6-bromo-3-ethenyl-2-pyridinyl)acetyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 162089578) has the molecular formula C23H29BrN2O4 and a molecular weight of 477.40 g/mol. Its IUPAC name is tert-butyl (1R,3S,5S)-3-[2-(6-bromo-3-ethenyl-2-pyridinyl)acetyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,5S)-3-[2-(6-bromo-3-ethenyl-2-pyridinyl)acetyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 162089578 |
| Molecular Formula | C23H29BrN2O4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | tert-butyl (1R,3S,5S)-3-[2-(6-bromo-3-ethenyl-2-pyridinyl)acetyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C=CCOC[C@@]12C[C@@H](C(=O)Cc3nc(Br)ccc3C=C)N(C(=O)OC(C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C23H29BrN2O4/c1-6-10-29-14-23-12-17(26(19(23)13-23)21(28)30-22(3,4)5)18(27)11-16-15(7-2)8-9-20(24)25-16/h6-9,17,19H,1-2,10-14H2,3-5H3/t17-,19+,23-/m0/s1 |
| InChIKey | VGVRKDLOCUFGKQ-GWJPWWOOSA-N |
| XLogP | 4.57 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|