C25H33BrFN3O4 — CID 167621601
tert-butyl (1R,3S,5R)-3-[2-(6-bromo-4-fluoro-2-pyridinyl)acetyl]-5-[[hex-5-enoyl(methyl)amino]methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 167621601) has the molecular formula C25H33BrFN3O4 and a molecular weight of 538.46 g/mol. Its IUPAC name is tert-butyl (1R,3S,5R)-3-[2-(6-bromo-4-fluoro-2-pyridinyl)acetyl]-5-[[hex-5-enoyl(methyl)amino]methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,5R)-3-[2-(6-bromo-4-fluoro-2-pyridinyl)acetyl]-5-[[hex-5-enoyl(methyl)amino]methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 167621601 |
| Molecular Formula | C25H33BrFN3O4 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | tert-butyl (1R,3S,5R)-3-[2-(6-bromo-4-fluoro-2-pyridinyl)acetyl]-5-[[hex-5-enoyl(methyl)amino]methyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C=CCCCC(=O)N(C)C[C@@]12C[C@@H](C(=O)Cc3cc(F)cc(Br)n3)N(C(=O)OC(C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C25H33BrFN3O4/c1-6-7-8-9-22(32)29(5)15-25-13-18(19(31)12-17-10-16(27)11-21(26)28-17)30(20(25)14-25)23(33)34-24(2,3)4/h6,10-11,18,20H,1,7-9,12-15H2,2-5H3/t18-,20+,25-/m0/s1 |
| InChIKey | JNCNTQHTANOFCY-NNPDTBDGSA-N |
| XLogP | 4.68 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|