C27H40BrN3O3 — CID 159019067
tert-butyl (1R,5R)-3-[2-[6-bromo-3-[[hexyl(methyl)amino]methyl]-2-pyridinyl]acetyl]-5-ethenyl-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 159019067) has the molecular formula C27H40BrN3O3 and a molecular weight of 534.54 g/mol. Its IUPAC name is tert-butyl (1R,5R)-3-[2-[6-bromo-3-[[hexyl(methyl)amino]methyl]-2-pyridinyl]acetyl]-5-ethenyl-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,5R)-3-[2-[6-bromo-3-[[hexyl(methyl)amino]methyl]-2-pyridinyl]acetyl]-5-ethenyl-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 159019067 |
| Molecular Formula | C27H40BrN3O3 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | tert-butyl (1R,5R)-3-[2-[6-bromo-3-[[hexyl(methyl)amino]methyl]-2-pyridinyl]acetyl]-5-ethenyl-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C=C[C@@]12CC(C(=O)Cc3nc(Br)ccc3CN(C)CCCCCC)N(C(=O)OC(C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C27H40BrN3O3/c1-7-9-10-11-14-30(6)18-19-12-13-24(28)29-20(19)15-22(32)21-16-27(8-2)17-23(27)31(21)25(33)34-26(3,4)5/h8,12-13,21,23H,2,7,9-11,14-18H2,1,3-6H3/t21?,23-,27+/m1/s1 |
| InChIKey | ZMUSCJHQQHWIPJ-QHGYMGQKSA-N |
| XLogP | 5.92 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|