C54H76O6 — CID 126647164
(2E,4E,6E,8E,10E,12E,14E)-15-(1,2-dihydroxy-2,6,6-trimethylcyclohexyl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal (PubChem CID 126647164) has the molecular formula C54H76O6 and a molecular weight of 821.20 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E)-15-(1,2-dihydroxy-2,6,6-trimethylcyclohexyl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E)-15-(1,2-dihydroxy-2,6,6-trimethylcyclohexyl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal |
|---|---|
| PubChem CID | 126647164 |
| Molecular Formula | C54H76O6 |
| Molecular Weight | 821.20 g/mol |
| Exact Mass | 820.56 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-15-(1,2-dihydroxy-2,6,6-trimethylcyclohexyl)-4,9,13-trimethylpentadeca-2,4,6,8,10,12,14-heptaenal |
| SMILES | CC(/C=C/C=O)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C1(O)C(C)(C)CCCC1(C)O.CC(/C=C/C=O)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C1(O)C(C)(C)CCCC1(C)O |
| InChI | InChI=1S/2C27H38O3/c2*1-22(12-7-8-13-23(2)16-10-21-28)14-9-15-24(3)17-20-27(30)25(4,5)18-11-19-26(27,6)29/h2*7-10,12-17,20-21,29-30H,11,18-19H2,1-6H3/b2*8-7+,14-9+,16-10+,20-17+,22-12+,23-13+,24-15+ |
| InChIKey | UYOFZHHMSOSECO-KJKBDUBZSA-N |
| XLogP | 11.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.20 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|