C21H34O8 — CID 162864571
[(2R,3R,4S,5S,6S)-2,4,5-trihydroxy-6-methyloxan-3-yl] 5-[(1R,2R)-1,2-dihydroxy-2,6,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoate (PubChem CID 162864571) has the molecular formula C21H34O8 and a molecular weight of 414.50 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2,4,5-trihydroxy-6-methyloxan-3-yl] 5-[(1R,2R)-1,2-dihydroxy-2,6,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoate.
| Compound Name | [(2R,3R,4S,5S,6S)-2,4,5-trihydroxy-6-methyloxan-3-yl] 5-[(1R,2R)-1,2-dihydroxy-2,6,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 162864571 |
| Molecular Formula | C21H34O8 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2,4,5-trihydroxy-6-methyloxan-3-yl] 5-[(1R,2R)-1,2-dihydroxy-2,6,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienoate |
| SMILES | CC(C=C[C@@]1(O)C(C)(C)CCC[C@@]1(C)O)=CC(=O)O[C@@H]1[C@@H](O)[C@H](O)[C@H](C)O[C@H]1O |
| InChI | InChI=1S/C21H34O8/c1-12(7-10-21(27)19(3,4)8-6-9-20(21,5)26)11-14(22)29-17-16(24)15(23)13(2)28-18(17)25/h7,10-11,13,15-18,23-27H,6,8-9H2,1-5H3/t13-,15+,16-,17+,18+,20+,21+/m0/s1 |
| InChIKey | PWQKQVLQUSQBJV-CQZDOFRRSA-N |
| XLogP | 0.55 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|