C21H36O8 — CID 123855925
4-[2-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]-1-hydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-one (PubChem CID 123855925) has the molecular formula C21H36O8 and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-[2-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]-1-hydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-one.
| Compound Name | 4-[2-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]-1-hydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 123855925 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 4-[2-[(4,5-dihydroxy-3,6-dimethoxyoxan-2-yl)methoxy]-1-hydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-one |
| SMILES | COC1OC(COC2(C)CCCC(C)(C)C2(O)C=CC(C)=O)C(OC)C(O)C1O |
| InChI | InChI=1S/C21H36O8/c1-13(22)8-11-21(25)19(2,3)9-7-10-20(21,4)28-12-14-17(26-5)15(23)16(24)18(27-6)29-14/h8,11,14-18,23-25H,7,9-10,12H2,1-6H3 |
| InChIKey | WDSYEIFYKQFQQE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|