C20H30ClNO3S — CID 126652372
ethyl 1-tert-butylsulfinyl-6-[(4-chlorophenyl)methyl]-3-methylpiperidine-3-carboxylate (PubChem CID 126652372) has the molecular formula C20H30ClNO3S and a molecular weight of 399.98 g/mol. Its IUPAC name is ethyl 1-tert-butylsulfinyl-6-[(4-chlorophenyl)methyl]-3-methylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-tert-butylsulfinyl-6-[(4-chlorophenyl)methyl]-3-methylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 126652372 |
| Molecular Formula | C20H30ClNO3S |
| Molecular Weight | 399.98 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | ethyl 1-tert-butylsulfinyl-6-[(4-chlorophenyl)methyl]-3-methylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(Cc2ccc(Cl)cc2)N(S(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H30ClNO3S/c1-6-25-18(23)20(5)12-11-17(13-15-7-9-16(21)10-8-15)22(14-20)26(24)19(2,3)4/h7-10,17H,6,11-14H2,1-5H3 |
| InChIKey | DYMDVTZMNUFGOR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |