C17H10F5N6O3+ — CID 126653113
[2,6-difluoro-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methoxy]benzoyl]imino-iminoazanium (PubChem CID 126653113) has the molecular formula C17H10F5N6O3+ and a molecular weight of 441.30 g/mol. Its IUPAC name is [2,6-difluoro-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methoxy]benzoyl]imino-iminoazanium.
| Compound Name | [2,6-difluoro-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methoxy]benzoyl]imino-iminoazanium |
|---|---|
| PubChem CID | 126653113 |
| Molecular Formula | C17H10F5N6O3+ |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | [2,6-difluoro-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methoxy]benzoyl]imino-iminoazanium |
| SMILES | N=[N+]=NC(=O)c1c(F)cc(OCc2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C17H10F5N6O3/c18-12-5-11(6-13(19)15(12)16(29)25-27-23)30-7-14-24-8-28(26-14)9-1-3-10(4-2-9)31-17(20,21)22/h1-6,8,23H,7H2/q+1 |
| InChIKey | BYMKUKRXZYBABL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|