C18H15F3N7O3+ — CID 126670030
imino-[3-methoxy-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methylamino]benzoyl]iminoazanium (PubChem CID 126670030) has the molecular formula C18H15F3N7O3+ and a molecular weight of 434.36 g/mol. Its IUPAC name is imino-[3-methoxy-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methylamino]benzoyl]iminoazanium.
| Compound Name | imino-[3-methoxy-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methylamino]benzoyl]iminoazanium |
|---|---|
| PubChem CID | 126670030 |
| Molecular Formula | C18H15F3N7O3+ |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | imino-[3-methoxy-4-[[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]methylamino]benzoyl]iminoazanium |
| SMILES | COc1cc(C(=O)N=[N+]=N)ccc1NCc1ncn(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H14F3N7O3/c1-30-15-8-11(17(29)25-27-22)2-7-14(15)23-9-16-24-10-28(26-16)12-3-5-13(6-4-12)31-18(19,20)21/h2-8,10,22H,9H2,1H3/p+1 |
| InChIKey | MGHYRAUINBSELY-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|