C30H24F6N6O5S — CID 155580822
(3Z)-1-[2-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 155580822) has the molecular formula C30H24F6N6O5S and a molecular weight of 694.61 g/mol. Its IUPAC name is (3Z)-1-[2-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[2-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 155580822 |
| Molecular Formula | C30H24F6N6O5S |
| Molecular Weight | 694.61 g/mol |
| Exact Mass | 694.14 |
| IUPAC Name | (3Z)-1-[2-methoxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | COc1cc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)ccc1NC(=O)/N=C1\SCC(=O)N1c1cc(C)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C30H24F6N6O5S/c1-17-3-10-23(46-12-11-29(31,32)33)22(13-17)42-25(43)15-48-28(42)39-27(44)38-21-9-4-18(14-24(21)45-2)26-37-16-41(40-26)19-5-7-20(8-6-19)47-30(34,35)36/h3-10,13-14,16H,11-12,15H2,1-2H3,(H,38,44)/b39-28- |
| InChIKey | VOURRZQVXOLOEE-WGSLGHPRSA-N |
| XLogP | 7.15 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|