C29H20F7N5O4S2 — CID 155581575
(3Z)-1-[2-fluoro-4-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 155581575) has the molecular formula C29H20F7N5O4S2 and a molecular weight of 699.63 g/mol. Its IUPAC name is (3Z)-1-[2-fluoro-4-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[2-fluoro-4-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 155581575 |
| Molecular Formula | C29H20F7N5O4S2 |
| Molecular Weight | 699.63 g/mol |
| Exact Mass | 699.08 |
| IUPAC Name | (3Z)-1-[2-fluoro-4-[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(OCCC(F)(F)F)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(-c3nnc(-c4ccc(OC(F)(F)F)cc4)s3)cc2F)c1 |
| InChI | InChI=1S/C29H20F7N5O4S2/c1-15-2-9-22(44-11-10-28(31,32)33)21(12-15)41-23(42)14-46-27(41)38-26(43)37-20-8-5-17(13-19(20)30)25-40-39-24(47-25)16-3-6-18(7-4-16)45-29(34,35)36/h2-9,12-13H,10-11,14H2,1H3,(H,37,43)/b38-27- |
| InChIKey | YKCNQAWZVWSIIM-SPKJYZRXSA-N |
| XLogP | 8.22 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.63 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|