C30H24F7N7O4S — CID 172831931
1-[3-[5-(dimethylamino)-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 172831931) has the molecular formula C30H24F7N7O4S and a molecular weight of 711.62 g/mol. Its IUPAC name is 1-[3-[5-(dimethylamino)-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[3-[5-(dimethylamino)-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 172831931 |
| Molecular Formula | C30H24F7N7O4S |
| Molecular Weight | 711.62 g/mol |
| Exact Mass | 711.15 |
| IUPAC Name | 1-[3-[5-(dimethylamino)-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CN(C)c1ccc(OCCC(F)(F)F)c(N2C(=O)CSC2=NC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2F)c1 |
| InChI | InChI=1S/C30H24F7N7O4S/c1-42(2)19-6-10-24(47-12-11-29(32,33)34)23(14-19)44-25(45)15-49-28(44)40-27(46)39-22-9-3-17(13-21(22)31)26-38-16-43(41-26)18-4-7-20(8-5-18)48-30(35,36)37/h3-10,13-14,16H,11-12,15H2,1-2H3,(H,39,46) |
| InChIKey | VPZBLSKLWNDLDY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|