C31H26F6N6O4S — CID 155580702
(3Z)-1-[2-ethyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 155580702) has the molecular formula C31H26F6N6O4S and a molecular weight of 692.64 g/mol. Its IUPAC name is (3Z)-1-[2-ethyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[2-ethyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 155580702 |
| Molecular Formula | C31H26F6N6O4S |
| Molecular Weight | 692.64 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | (3Z)-1-[2-ethyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | CCc1cc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)ccc1NC(=O)/N=C1\SCC(=O)N1c1cc(C)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C31H26F6N6O4S/c1-3-19-15-20(27-38-17-42(41-27)21-6-8-22(9-7-21)47-31(35,36)37)5-10-23(19)39-28(45)40-29-43(26(44)16-48-29)24-14-18(2)4-11-25(24)46-13-12-30(32,33)34/h4-11,14-15,17H,3,12-13,16H2,1-2H3,(H,39,45)/b40-29- |
| InChIKey | NXDFOZZHEFLJEN-MIDJFWNWSA-N |
| XLogP | 7.70 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|