C29H21F8N7O3S2 — CID 163283619
(3Z)-1-[2-cyano-4-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 163283619) has the molecular formula C29H21F8N7O3S2 and a molecular weight of 731.65 g/mol. Its IUPAC name is (3Z)-1-[2-cyano-4-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[2-cyano-4-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 163283619 |
| Molecular Formula | C29H21F8N7O3S2 |
| Molecular Weight | 731.65 g/mol |
| Exact Mass | 731.10 |
| IUPAC Name | (3Z)-1-[2-cyano-4-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(OCCC(F)(F)F)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(-c3ncn(-c4ccc(S(F)(F)(F)(F)F)cc4)n3)cc2C#N)c1 |
| InChI | InChI=1S/C29H21F8N7O3S2/c1-17-2-9-24(47-11-10-29(30,31)32)23(12-17)44-25(45)15-48-28(44)41-27(46)40-22-8-3-18(13-19(22)14-38)26-39-16-43(42-26)20-4-6-21(7-5-20)49(33,34,35,36)37/h2-9,12-13,16H,10-11,15H2,1H3,(H,40,46)/b41-28- |
| InChIKey | PAYOCXFJEYMMEZ-DUJXHPOHSA-N |
| XLogP | 8.77 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|