C10H21NO2 — CID 126655674
3,4-dimethoxy-1-propan-2-ylpiperidine (PubChem CID 126655674) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 3,4-dimethoxy-1-propan-2-ylpiperidine.
| Compound Name | 3,4-dimethoxy-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 126655674 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3,4-dimethoxy-1-propan-2-ylpiperidine |
| SMILES | COC1CCN(C(C)C)CC1OC |
| InChI | InChI=1S/C10H21NO2/c1-8(2)11-6-5-9(12-3)10(7-11)13-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | YUZMHXZQIWMYLB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |