About 6-(azepan-3-yl)-1,4-diazepane
6-(azepan-3-yl)-1,4-diazepane (PubChem CID 126656145) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 6-(azepan-3-yl)-1,4-diazepane.
Molecular Properties
| Compound Name | 6-(azepan-3-yl)-1,4-diazepane |
| PubChem CID | 126656145 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 6-(azepan-3-yl)-1,4-diazepane |
| SMILES | C1CCC(C2CNCCNC2)CNC1 |
| InChI | InChI=1S/C11H23N3/c1-2-4-12-7-10(3-1)11-8-13-5-6-14-9-11/h10-14H,1-9H2 |
| InChIKey | QKOPMZDAJVVAOX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(azepan-3-yl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(azepan-3-yl)-1,4-diazepane?
The IUPAC name of 6-(azepan-3-yl)-1,4-diazepane (CID 126656145) is 6-(azepan-3-yl)-1,4-diazepane.
What is the SMILES notation for 6-(azepan-3-yl)-1,4-diazepane?
The canonical SMILES for 6-(azepan-3-yl)-1,4-diazepane is C1CCC(C2CNCCNC2)CNC1.
What is the InChIKey of 6-(azepan-3-yl)-1,4-diazepane?
The InChIKey is QKOPMZDAJVVAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-2-4-12-7-10(3-1)11-8-13-5-6-14-9-11/h10-14H,1-9H2.
What are the key properties of 6-(azepan-3-yl)-1,4-diazepane?
6-(azepan-3-yl)-1,4-diazepane has a molecular weight of 197.33 g/mol, XLogP of 0.19, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(azepan-3-yl)-1,4-diazepane is sourced from PubChem (CID 126656145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).